C13H20BF3O3Si — CID 167733874
[3-[tert-butyl(dimethyl)silyl]oxy-5-(trifluoromethyl)phenyl]boronic acid (PubChem CID 167733874) has the molecular formula C13H20BF3O3Si and a molecular weight of 320.19 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxy-5-(trifluoromethyl)phenyl]boronic acid.
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxy-5-(trifluoromethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 167733874 |
| Molecular Formula | C13H20BF3O3Si |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxy-5-(trifluoromethyl)phenyl]boronic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc(B(O)O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H20BF3O3Si/c1-12(2,3)21(4,5)20-11-7-9(13(15,16)17)6-10(8-11)14(18)19/h6-8,18-19H,1-5H3 |
| InChIKey | YGLNUWILVLMWHL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|