C16H25F3O3Si — CID 123547238
2-[5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 123547238) has the molecular formula C16H25F3O3Si and a molecular weight of 350.45 g/mol. Its IUPAC name is 2-[5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 123547238 |
| Molecular Formula | C16H25F3O3Si |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-[5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)(c1cc(O[Si](C)(C)C(C)(C)C)ccc1CO)C(F)(F)F |
| InChI | InChI=1S/C16H25F3O3Si/c1-14(2,3)23(5,6)22-12-8-7-11(10-20)13(9-12)15(4,21)16(17,18)19/h7-9,20-21H,10H2,1-6H3 |
| InChIKey | PXMAYGMIWVOXLT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|