C15H25ClO2Si — CID 175118299
3-[4-[tert-butyl(dimethyl)silyl]oxy-2-chlorophenyl]propan-1-ol (PubChem CID 175118299) has the molecular formula C15H25ClO2Si and a molecular weight of 300.90 g/mol. Its IUPAC name is 3-[4-[tert-butyl(dimethyl)silyl]oxy-2-chlorophenyl]propan-1-ol.
| Compound Name | 3-[4-[tert-butyl(dimethyl)silyl]oxy-2-chlorophenyl]propan-1-ol |
|---|---|
| PubChem CID | 175118299 |
| Molecular Formula | C15H25ClO2Si |
| Molecular Weight | 300.90 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-[4-[tert-butyl(dimethyl)silyl]oxy-2-chlorophenyl]propan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(CCCO)c(Cl)c1 |
| InChI | InChI=1S/C15H25ClO2Si/c1-15(2,3)19(4,5)18-13-9-8-12(7-6-10-17)14(16)11-13/h8-9,11,17H,6-7,10H2,1-5H3 |
| InChIKey | SSQNWXGRUYXTER-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.90 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|