C14H21BrClNO2Si — CID 90291132
2-bromo-N-[4-[tert-butyl(dimethyl)silyl]oxy-2-chlorophenyl]acetamide (PubChem CID 90291132) has the molecular formula C14H21BrClNO2Si and a molecular weight of 378.77 g/mol. Its IUPAC name is 2-bromo-N-[4-[tert-butyl(dimethyl)silyl]oxy-2-chlorophenyl]acetamide.
| Compound Name | 2-bromo-N-[4-[tert-butyl(dimethyl)silyl]oxy-2-chlorophenyl]acetamide |
|---|---|
| PubChem CID | 90291132 |
| Molecular Formula | C14H21BrClNO2Si |
| Molecular Weight | 378.77 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 2-bromo-N-[4-[tert-butyl(dimethyl)silyl]oxy-2-chlorophenyl]acetamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(NC(=O)CBr)c(Cl)c1 |
| InChI | InChI=1S/C14H21BrClNO2Si/c1-14(2,3)20(4,5)19-10-6-7-12(11(16)8-10)17-13(18)9-15/h6-8H,9H2,1-5H3,(H,17,18) |
| InChIKey | RSTAMYLIYWELDU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.77 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|