C26H34ClNO3Si — CID 46201469
tert-butyl 5-[tert-butyl(dimethyl)silyl]oxy-2-[(3-chlorophenyl)methyl]indole-1-carboxylate (PubChem CID 46201469) has the molecular formula C26H34ClNO3Si and a molecular weight of 472.10 g/mol. Its IUPAC name is tert-butyl 5-[tert-butyl(dimethyl)silyl]oxy-2-[(3-chlorophenyl)methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 5-[tert-butyl(dimethyl)silyl]oxy-2-[(3-chlorophenyl)methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 46201469 |
| Molecular Formula | C26H34ClNO3Si |
| Molecular Weight | 472.10 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | tert-butyl 5-[tert-butyl(dimethyl)silyl]oxy-2-[(3-chlorophenyl)methyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(Cc2cccc(Cl)c2)cc2cc(O[Si](C)(C)C(C)(C)C)ccc21 |
| InChI | InChI=1S/C26H34ClNO3Si/c1-25(2,3)30-24(29)28-21(15-18-10-9-11-20(27)14-18)16-19-17-22(12-13-23(19)28)31-32(7,8)26(4,5)6/h9-14,16-17H,15H2,1-8H3 |
| InChIKey | ZWURNUIJZNZRQA-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.10 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|