C24H22ClN3O3 — CID 44754983
tert-butyl 2-(2-chloropyrimidin-4-yl)-5-phenylmethoxyindole-1-carboxylate (PubChem CID 44754983) has the molecular formula C24H22ClN3O3 and a molecular weight of 435.91 g/mol. Its IUPAC name is tert-butyl 2-(2-chloropyrimidin-4-yl)-5-phenylmethoxyindole-1-carboxylate.
| Compound Name | tert-butyl 2-(2-chloropyrimidin-4-yl)-5-phenylmethoxyindole-1-carboxylate |
|---|---|
| PubChem CID | 44754983 |
| Molecular Formula | C24H22ClN3O3 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | tert-butyl 2-(2-chloropyrimidin-4-yl)-5-phenylmethoxyindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(-c2ccnc(Cl)n2)cc2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C24H22ClN3O3/c1-24(2,3)31-23(29)28-20-10-9-18(30-15-16-7-5-4-6-8-16)13-17(20)14-21(28)19-11-12-26-22(25)27-19/h4-14H,15H2,1-3H3 |
| InChIKey | GHBDTCJLMDQODA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |