C36H41N3O9 — CID 155557546
tert-butyl 2-[(1-benzylpiperidin-4-yl)carbamoyloxymethyl]-5-phenylmethoxyindole-1-carboxylate;oxalic acid (PubChem CID 155557546) has the molecular formula C36H41N3O9 and a molecular weight of 659.74 g/mol. Its IUPAC name is tert-butyl 2-[(1-benzylpiperidin-4-yl)carbamoyloxymethyl]-5-phenylmethoxyindole-1-carboxylate;oxalic acid.
| Compound Name | tert-butyl 2-[(1-benzylpiperidin-4-yl)carbamoyloxymethyl]-5-phenylmethoxyindole-1-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 155557546 |
| Molecular Formula | C36H41N3O9 |
| Molecular Weight | 659.74 g/mol |
| Exact Mass | 659.28 |
| IUPAC Name | tert-butyl 2-[(1-benzylpiperidin-4-yl)carbamoyloxymethyl]-5-phenylmethoxyindole-1-carboxylate;oxalic acid |
| SMILES | CC(C)(C)OC(=O)n1c(COC(=O)NC2CCN(Cc3ccccc3)CC2)cc2cc(OCc3ccccc3)ccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C34H39N3O5.C2H2O4/c1-34(2,3)42-33(39)37-29(20-27-21-30(14-15-31(27)37)40-23-26-12-8-5-9-13-26)24-41-32(38)35-28-16-18-36(19-17-28)22-25-10-6-4-7-11-25;3-1(4)2(5)6/h4-15,20-21,28H,16-19,22-24H2,1-3H3,(H,35,38);(H,3,4)(H,5,6) |
| InChIKey | RAJQURIXXBNLHY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 156.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.74 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|