C28H33N3O2 — CID 54424840
(2S)-2-amino-N-(1-benzylpiperidin-4-yl)-3-(4-phenylmethoxyphenyl)propanamide (PubChem CID 54424840) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is (2S)-2-amino-N-(1-benzylpiperidin-4-yl)-3-(4-phenylmethoxyphenyl)propanamide.
| Compound Name | (2S)-2-amino-N-(1-benzylpiperidin-4-yl)-3-(4-phenylmethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 54424840 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | (2S)-2-amino-N-(1-benzylpiperidin-4-yl)-3-(4-phenylmethoxyphenyl)propanamide |
| SMILES | N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H33N3O2/c29-27(19-22-11-13-26(14-12-22)33-21-24-9-5-2-6-10-24)28(32)30-25-15-17-31(18-16-25)20-23-7-3-1-4-8-23/h1-14,25,27H,15-21,29H2,(H,30,32)/t27-/m0/s1 |
| InChIKey | WDIZDHWRJBSESX-MHZLTWQESA-N |
| XLogP | 3.92 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |