C20H21BNO5 — CID 153276556
CID 153276556 (PubChem CID 153276556) has the molecular formula C20H21BNO5 and a molecular weight of 366.20 g/mol.
| Compound Name | CID 153276556 |
|---|---|
| PubChem CID | 153276556 |
| Molecular Formula | C20H21BNO5 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)n1c(O[B]O)cc2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C20H21BNO5/c1-20(2,3)26-19(23)22-17-12-16(25-13-14-7-5-4-6-8-14)10-9-15(17)11-18(22)27-21-24/h4-12,24H,13H2,1-3H3 |
| InChIKey | XQKLDHLBRSPOSF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|