C22H22N2O3 — CID 66640267
tert-butyl 3-(cyanomethyl)-6-phenylmethoxyindole-1-carboxylate (PubChem CID 66640267) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is tert-butyl 3-(cyanomethyl)-6-phenylmethoxyindole-1-carboxylate.
| Compound Name | tert-butyl 3-(cyanomethyl)-6-phenylmethoxyindole-1-carboxylate |
|---|---|
| PubChem CID | 66640267 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | tert-butyl 3-(cyanomethyl)-6-phenylmethoxyindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(CC#N)c2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C22H22N2O3/c1-22(2,3)27-21(25)24-14-17(11-12-23)19-10-9-18(13-20(19)24)26-15-16-7-5-4-6-8-16/h4-10,13-14H,11,15H2,1-3H3 |
| InChIKey | GVDAZRNFWIUBGH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |