C38H36N2O7 — CID 149239561
benzyl 3-[(Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-phenylmethoxyprop-1-enyl]-6-phenylmethoxyindole-1-carboxylate (PubChem CID 149239561) has the molecular formula C38H36N2O7 and a molecular weight of 632.71 g/mol. Its IUPAC name is benzyl 3-[(Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-phenylmethoxyprop-1-enyl]-6-phenylmethoxyindole-1-carboxylate.
| Compound Name | benzyl 3-[(Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-phenylmethoxyprop-1-enyl]-6-phenylmethoxyindole-1-carboxylate |
|---|---|
| PubChem CID | 149239561 |
| Molecular Formula | C38H36N2O7 |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | benzyl 3-[(Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-phenylmethoxyprop-1-enyl]-6-phenylmethoxyindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N/C(=C\c1cn(C(=O)OCc2ccccc2)c2cc(OCc3ccccc3)ccc12)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H36N2O7/c1-38(2,3)47-36(42)39-33(35(41)45-25-28-15-9-5-10-16-28)21-30-23-40(37(43)46-26-29-17-11-6-12-18-29)34-22-31(19-20-32(30)34)44-24-27-13-7-4-8-14-27/h4-23H,24-26H2,1-3H3,(H,39,42)/b33-21- |
| InChIKey | XLXJYAORMDHDOP-HWIUFGAZSA-N |
| XLogP | 8.01 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|