C21H22BrNO4 — CID 177452491
benzyl (Z)-3-(2-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoate (PubChem CID 177452491) has the molecular formula C21H22BrNO4 and a molecular weight of 432.31 g/mol. Its IUPAC name is benzyl (Z)-3-(2-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoate.
| Compound Name | benzyl (Z)-3-(2-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoate |
|---|---|
| PubChem CID | 177452491 |
| Molecular Formula | C21H22BrNO4 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | benzyl (Z)-3-(2-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)N/C(=C\c1ccccc1Br)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H22BrNO4/c1-21(2,3)27-20(25)23-18(13-16-11-7-8-12-17(16)22)19(24)26-14-15-9-5-4-6-10-15/h4-13H,14H2,1-3H3,(H,23,25)/b18-13- |
| InChIKey | ZWFBDYYTNWIZPM-AQTBWJFISA-N |
| XLogP | 5.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|