C26H28N2O6 — CID 101204984
benzyl 3-[(Z)-3-ethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxoprop-1-enyl]indole-1-carboxylate (PubChem CID 101204984) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is benzyl 3-[(Z)-3-ethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxoprop-1-enyl]indole-1-carboxylate.
| Compound Name | benzyl 3-[(Z)-3-ethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxoprop-1-enyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 101204984 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | benzyl 3-[(Z)-3-ethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxoprop-1-enyl]indole-1-carboxylate |
| SMILES | CCOC(=O)/C(=C/c1cn(C(=O)OCc2ccccc2)c2ccccc12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H28N2O6/c1-5-32-23(29)21(27-24(30)34-26(2,3)4)15-19-16-28(22-14-10-9-13-20(19)22)25(31)33-17-18-11-7-6-8-12-18/h6-16H,5,17H2,1-4H3,(H,27,30)/b21-15- |
| InChIKey | BNEDDQWNMYMKFU-QNGOZBTKSA-N |
| XLogP | 5.25 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|