C17H12NO4- — CID 86198178
1-phenylmethoxycarbonylindole-3-carboxylate (PubChem CID 86198178) has the molecular formula C17H12NO4- and a molecular weight of 294.29 g/mol. Its IUPAC name is 1-phenylmethoxycarbonylindole-3-carboxylate.
| Compound Name | 1-phenylmethoxycarbonylindole-3-carboxylate |
|---|---|
| PubChem CID | 86198178 |
| Molecular Formula | C17H12NO4- |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1-phenylmethoxycarbonylindole-3-carboxylate |
| SMILES | O=C([O-])c1cn(C(=O)OCc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C17H13NO4/c19-16(20)14-10-18(15-9-5-4-8-13(14)15)17(21)22-11-12-6-2-1-3-7-12/h1-10H,11H2,(H,19,20)/p-1 |
| InChIKey | YVIPZHHGDRJMBU-UHFFFAOYSA-M |
| XLogP | 2.19 |
| TPSA | 71.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |