C29H24FN3O5 — CID 506469
benzyl 3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoroindole-1-carboxylate (PubChem CID 506469) has the molecular formula C29H24FN3O5 and a molecular weight of 513.53 g/mol. Its IUPAC name is benzyl 3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoroindole-1-carboxylate.
| Compound Name | benzyl 3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoroindole-1-carboxylate |
|---|---|
| PubChem CID | 506469 |
| Molecular Formula | C29H24FN3O5 |
| Molecular Weight | 513.53 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | benzyl 3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoroindole-1-carboxylate |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2ccccc2)CC1)c1cn(C(=O)OCc2ccccc2)c2cccc(F)c12 |
| InChI | InChI=1S/C29H24FN3O5/c30-23-12-7-13-24-25(23)22(18-33(24)29(37)38-19-20-8-3-1-4-9-20)26(34)28(36)32-16-14-31(15-17-32)27(35)21-10-5-2-6-11-21/h1-13,18H,14-17,19H2 |
| InChIKey | LRNYCRTVJBTDSW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|