C27H23FN4O3 — CID 506438
1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-1-(pyridin-2-ylmethyl)indol-3-yl]ethane-1,2-dione (PubChem CID 506438) has the molecular formula C27H23FN4O3 and a molecular weight of 470.50 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-1-(pyridin-2-ylmethyl)indol-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-1-(pyridin-2-ylmethyl)indol-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 506438 |
| Molecular Formula | C27H23FN4O3 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-1-(pyridin-2-ylmethyl)indol-3-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2ccccc2)CC1)c1cn(Cc2ccccn2)c2cccc(F)c12 |
| InChI | InChI=1S/C27H23FN4O3/c28-22-10-6-11-23-24(22)21(18-32(23)17-20-9-4-5-12-29-20)25(33)27(35)31-15-13-30(14-16-31)26(34)19-7-2-1-3-8-19/h1-12,18H,13-17H2 |
| InChIKey | RHPLPAWRUWYQCD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|