C25H25N3O5 — CID 17365950
oxalic acid;(4-phenylphenyl)-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 17365950) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is oxalic acid;(4-phenylphenyl)-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | oxalic acid;(4-phenylphenyl)-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 17365950 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | oxalic acid;(4-phenylphenyl)-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(O)C(=O)O.O=C(c1ccc(-c2ccccc2)cc1)N1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C23H23N3O.C2H2O4/c27-23(21-11-9-20(10-12-21)19-6-2-1-3-7-19)26-16-14-25(15-17-26)18-22-8-4-5-13-24-22;3-1(4)2(5)6/h1-13H,14-18H2;(H,3,4)(H,5,6) |
| InChIKey | OPEAINCXNDVXFX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|