C22H28N4O — CID 35901272
[4-[[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 35901272) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is [4-[[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 35901272 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | [4-[[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccc(CN2CCN(Cc3ccccn3)CC2)cc1)N1CCCC1 |
| InChI | InChI=1S/C22H28N4O/c27-22(26-11-3-4-12-26)20-8-6-19(7-9-20)17-24-13-15-25(16-14-24)18-21-5-1-2-10-23-21/h1-2,5-10H,3-4,11-18H2 |
| InChIKey | KBFDWMVMLDFLQJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |