C42H50N4O2 — CID 102452261
4-pentyl-N-[[4-[4-(piperidine-1-carbonyl)phenyl]phenyl]methyl]-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide (PubChem CID 102452261) has the molecular formula C42H50N4O2 and a molecular weight of 642.89 g/mol. Its IUPAC name is 4-pentyl-N-[[4-[4-(piperidine-1-carbonyl)phenyl]phenyl]methyl]-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide.
| Compound Name | 4-pentyl-N-[[4-[4-(piperidine-1-carbonyl)phenyl]phenyl]methyl]-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 102452261 |
| Molecular Formula | C42H50N4O2 |
| Molecular Weight | 642.89 g/mol |
| Exact Mass | 642.39 |
| IUPAC Name | 4-pentyl-N-[[4-[4-(piperidine-1-carbonyl)phenyl]phenyl]methyl]-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2ccc(-c3ccc(C(=O)N4CCCCC4)cc3)cc2)C2CCN(Cc3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C42H50N4O2/c1-2-3-5-10-33-12-18-38(19-13-33)42(48)46(40-24-29-44(30-25-40)32-39-11-6-7-26-43-39)31-34-14-16-35(17-15-34)36-20-22-37(23-21-36)41(47)45-27-8-4-9-28-45/h6-7,11-23,26,40H,2-5,8-10,24-25,27-32H2,1H3 |
| InChIKey | KIKNOGFPIXJHBJ-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.89 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|