C38H46N4O — CID 11365179
N-[[4-[benzyl(methyl)amino]phenyl]methyl]-4-pentyl-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide (PubChem CID 11365179) has the molecular formula C38H46N4O and a molecular weight of 574.81 g/mol. Its IUPAC name is N-[[4-[benzyl(methyl)amino]phenyl]methyl]-4-pentyl-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide.
| Compound Name | N-[[4-[benzyl(methyl)amino]phenyl]methyl]-4-pentyl-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 11365179 |
| Molecular Formula | C38H46N4O |
| Molecular Weight | 574.81 g/mol |
| Exact Mass | 574.37 |
| IUPAC Name | N-[[4-[benzyl(methyl)amino]phenyl]methyl]-4-pentyl-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2ccc(N(C)Cc3ccccc3)cc2)C2CCN(Cc3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C38H46N4O/c1-3-4-6-11-31-15-19-34(20-16-31)38(43)42(37-23-26-41(27-24-37)30-35-14-9-10-25-39-35)29-33-17-21-36(22-18-33)40(2)28-32-12-7-5-8-13-32/h5,7-10,12-22,25,37H,3-4,6,11,23-24,26-30H2,1-2H3 |
| InChIKey | HFZRMTFAXDRCEG-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.81 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|