C41H46N4O3 — CID 11570990
benzyl N-[3-[3-[[(4-pentylbenzoyl)-[1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]methyl]phenyl]prop-2-ynyl]carbamate (PubChem CID 11570990) has the molecular formula C41H46N4O3 and a molecular weight of 642.84 g/mol. Its IUPAC name is benzyl N-[3-[3-[[(4-pentylbenzoyl)-[1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]methyl]phenyl]prop-2-ynyl]carbamate.
| Compound Name | benzyl N-[3-[3-[[(4-pentylbenzoyl)-[1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]methyl]phenyl]prop-2-ynyl]carbamate |
|---|---|
| PubChem CID | 11570990 |
| Molecular Formula | C41H46N4O3 |
| Molecular Weight | 642.84 g/mol |
| Exact Mass | 642.36 |
| IUPAC Name | benzyl N-[3-[3-[[(4-pentylbenzoyl)-[1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]methyl]phenyl]prop-2-ynyl]carbamate |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2cccc(C#CCNC(=O)OCc3ccccc3)c2)C2CCN(Cc3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C41H46N4O3/c1-2-3-5-12-33-19-21-37(22-20-33)40(46)45(39-23-27-44(28-24-39)31-38-18-8-9-25-42-38)30-36-16-10-15-34(29-36)17-11-26-43-41(47)48-32-35-13-6-4-7-14-35/h4,6-10,13-16,18-22,25,29,39H,2-3,5,12,23-24,26-28,30-32H2,1H3,(H,43,47) |
| InChIKey | XNIYAWDMXRISCT-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.84 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|