C33H46N2O2 — CID 11605797
N-[[3-(4-hydroxybut-1-ynyl)phenyl]methyl]-N-[1-(3-methylbutyl)piperidin-4-yl]-4-pentylbenzamide (PubChem CID 11605797) has the molecular formula C33H46N2O2 and a molecular weight of 502.74 g/mol. Its IUPAC name is N-[[3-(4-hydroxybut-1-ynyl)phenyl]methyl]-N-[1-(3-methylbutyl)piperidin-4-yl]-4-pentylbenzamide.
| Compound Name | N-[[3-(4-hydroxybut-1-ynyl)phenyl]methyl]-N-[1-(3-methylbutyl)piperidin-4-yl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 11605797 |
| Molecular Formula | C33H46N2O2 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.36 |
| IUPAC Name | N-[[3-(4-hydroxybut-1-ynyl)phenyl]methyl]-N-[1-(3-methylbutyl)piperidin-4-yl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2cccc(C#CCCO)c2)C2CCN(CCC(C)C)CC2)cc1 |
| InChI | InChI=1S/C33H46N2O2/c1-4-5-6-10-28-14-16-31(17-15-28)33(37)35(32-19-22-34(23-20-32)21-18-27(2)3)26-30-13-9-12-29(25-30)11-7-8-24-36/h9,12-17,25,27,32,36H,4-6,8,10,18-24,26H2,1-3H3 |
| InChIKey | MKWKVMQZJQXYKT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|