C34H54N2O — CID 11519048
N-[1-(3-methylbutyl)piperidin-4-yl]-4-pentyl-N-[(3-pent-1-ynylphenyl)methyl]cyclohexane-1-carboxamide (PubChem CID 11519048) has the molecular formula C34H54N2O and a molecular weight of 506.82 g/mol. Its IUPAC name is N-[1-(3-methylbutyl)piperidin-4-yl]-4-pentyl-N-[(3-pent-1-ynylphenyl)methyl]cyclohexane-1-carboxamide.
| Compound Name | N-[1-(3-methylbutyl)piperidin-4-yl]-4-pentyl-N-[(3-pent-1-ynylphenyl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11519048 |
| Molecular Formula | C34H54N2O |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 506.42 |
| IUPAC Name | N-[1-(3-methylbutyl)piperidin-4-yl]-4-pentyl-N-[(3-pent-1-ynylphenyl)methyl]cyclohexane-1-carboxamide |
| SMILES | CCCC#Cc1cccc(CN(C(=O)C2CCC(CCCCC)CC2)C2CCN(CCC(C)C)CC2)c1 |
| InChI | InChI=1S/C34H54N2O/c1-5-7-9-12-29-16-18-32(19-17-29)34(37)36(33-21-24-35(25-22-33)23-20-28(3)4)27-31-15-11-14-30(26-31)13-10-8-6-2/h11,14-15,26,28-29,32-33H,5-9,12,16-25,27H2,1-4H3 |
| InChIKey | HEPRJNOZZHNGFM-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|