C25H32F3N3O — CID 126696222
1-benzyl-1-[1-(3-methylbutyl)piperidin-4-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 126696222) has the molecular formula C25H32F3N3O and a molecular weight of 447.55 g/mol. Its IUPAC name is 1-benzyl-1-[1-(3-methylbutyl)piperidin-4-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-benzyl-1-[1-(3-methylbutyl)piperidin-4-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 126696222 |
| Molecular Formula | C25H32F3N3O |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 1-benzyl-1-[1-(3-methylbutyl)piperidin-4-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CC(C)CCN1CCC(N(Cc2ccccc2)C(=O)Nc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C25H32F3N3O/c1-19(2)11-14-30-15-12-23(13-16-30)31(18-20-7-4-3-5-8-20)24(32)29-22-10-6-9-21(17-22)25(26,27)28/h3-10,17,19,23H,11-16,18H2,1-2H3,(H,29,32) |
| InChIKey | MHLBIZSDRMWMEV-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |