C24H30F3N3OS — CID 145278496
1-benzyl-1-(1-butylsulfanylpiperidin-4-yl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 145278496) has the molecular formula C24H30F3N3OS and a molecular weight of 465.59 g/mol. Its IUPAC name is 1-benzyl-1-(1-butylsulfanylpiperidin-4-yl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-benzyl-1-(1-butylsulfanylpiperidin-4-yl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 145278496 |
| Molecular Formula | C24H30F3N3OS |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 1-benzyl-1-(1-butylsulfanylpiperidin-4-yl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CCCCSN1CCC(N(Cc2ccccc2)C(=O)Nc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C24H30F3N3OS/c1-2-3-16-32-29-14-12-22(13-15-29)30(18-19-8-5-4-6-9-19)23(31)28-21-11-7-10-20(17-21)24(25,26)27/h4-11,17,22H,2-3,12-16,18H2,1H3,(H,28,31) |
| InChIKey | XIHXQTMGAQGAPU-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|