C19H28F3N3O — CID 126696237
1-propyl-1-(1-propylpiperidin-4-yl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 126696237) has the molecular formula C19H28F3N3O and a molecular weight of 371.45 g/mol. Its IUPAC name is 1-propyl-1-(1-propylpiperidin-4-yl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-propyl-1-(1-propylpiperidin-4-yl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 126696237 |
| Molecular Formula | C19H28F3N3O |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-propyl-1-(1-propylpiperidin-4-yl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CCCN1CCC(N(CCC)C(=O)Nc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H28F3N3O/c1-3-10-24-12-8-17(9-13-24)25(11-4-2)18(26)23-16-7-5-6-15(14-16)19(20,21)22/h5-7,14,17H,3-4,8-13H2,1-2H3,(H,23,26) |
| InChIKey | SPQBEWRIVKFIRA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |