C13H18F3N3O — CID 61349730
1-(2-aminoethyl)-1-propyl-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 61349730) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is 1-(2-aminoethyl)-1-propyl-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2-aminoethyl)-1-propyl-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 61349730 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-(2-aminoethyl)-1-propyl-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CCCN(CCN)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3N3O/c1-2-7-19(8-6-17)12(20)18-11-5-3-4-10(9-11)13(14,15)16/h3-5,9H,2,6-8,17H2,1H3,(H,18,20) |
| InChIKey | NLAXVUNZELMVQW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |