C18H27F3N2S — CID 19653312
1,1-dipentyl-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 19653312) has the molecular formula C18H27F3N2S and a molecular weight of 360.49 g/mol. Its IUPAC name is 1,1-dipentyl-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1,1-dipentyl-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 19653312 |
| Molecular Formula | C18H27F3N2S |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 1,1-dipentyl-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | CCCCCN(CCCCC)C(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H27F3N2S/c1-3-5-7-12-23(13-8-6-4-2)17(24)22-16-11-9-10-15(14-16)18(19,20)21/h9-11,14H,3-8,12-13H2,1-2H3,(H,22,24) |
| InChIKey | LHVQQRKYTDVNHQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|