C9H8F3NS — CID 3038368
N-[3-(trifluoromethyl)phenyl]ethanethioamide (PubChem CID 3038368) has the molecular formula C9H8F3NS and a molecular weight of 219.23 g/mol. Its IUPAC name is N-[3-(trifluoromethyl)phenyl]ethanethioamide.
| Compound Name | N-[3-(trifluoromethyl)phenyl]ethanethioamide |
|---|---|
| PubChem CID | 3038368 |
| Molecular Formula | C9H8F3NS |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | N-[3-(trifluoromethyl)phenyl]ethanethioamide |
| SMILES | CC(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H8F3NS/c1-6(14)13-8-4-2-3-7(5-8)9(10,11)12/h2-5H,1H3,(H,13,14) |
| InChIKey | GPRNWYQPMXUEGO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|