C9H10F3N5S — CID 45033851
1-(diaminomethylideneamino)-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 45033851) has the molecular formula C9H10F3N5S and a molecular weight of 277.28 g/mol. Its IUPAC name is 1-(diaminomethylideneamino)-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(diaminomethylideneamino)-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 45033851 |
| Molecular Formula | C9H10F3N5S |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 1-(diaminomethylideneamino)-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | NC(N)=NNC(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H10F3N5S/c10-9(11,12)5-2-1-3-6(4-5)15-8(18)17-16-7(13)14/h1-4H,(H4,13,14,16)(H2,15,17,18) |
| InChIKey | VHLWNQJCHBGFIX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|