C16H12Cl2F3N3OS — CID 135854175
1-[(Z)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 135854175) has the molecular formula C16H12Cl2F3N3OS and a molecular weight of 422.26 g/mol. Its IUPAC name is 1-[(Z)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(Z)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 135854175 |
| Molecular Formula | C16H12Cl2F3N3OS |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 421.00 |
| IUPAC Name | 1-[(Z)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | C/C(=N/NC(=S)Nc1cccc(C(F)(F)F)c1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C16H12Cl2F3N3OS/c1-8(12-6-10(17)7-13(18)14(12)25)23-24-15(26)22-11-4-2-3-9(5-11)16(19,20)21/h2-7,25H,1H3,(H2,22,24,26)/b23-8- |
| InChIKey | AOFVAJLQPOUSIG-NYAPKIOYSA-N |
| XLogP | 5.43 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|