C15H11Cl2FN2O2 — CID 135676383
N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-4-fluorobenzamide (PubChem CID 135676383) has the molecular formula C15H11Cl2FN2O2 and a molecular weight of 341.17 g/mol. Its IUPAC name is N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-4-fluorobenzamide.
| Compound Name | N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-4-fluorobenzamide |
|---|---|
| PubChem CID | 135676383 |
| Molecular Formula | C15H11Cl2FN2O2 |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-4-fluorobenzamide |
| SMILES | C/C(=N\NC(=O)c1ccc(F)cc1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C15H11Cl2FN2O2/c1-8(12-6-10(16)7-13(17)14(12)21)19-20-15(22)9-2-4-11(18)5-3-9/h2-7,21H,1H3,(H,20,22)/b19-8+ |
| InChIKey | IREZZMCFXDBPFO-UFWORHAWSA-N |
| XLogP | 3.99 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|