C15H11Cl3N2O2 — CID 3299264
4-chloro-N-[1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]benzamide (PubChem CID 3299264) has the molecular formula C15H11Cl3N2O2 and a molecular weight of 357.62 g/mol. Its IUPAC name is 4-chloro-N-[1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]benzamide.
| Compound Name | 4-chloro-N-[1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 3299264 |
| Molecular Formula | C15H11Cl3N2O2 |
| Molecular Weight | 357.62 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 4-chloro-N-[1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccc(Cl)cc1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C15H11Cl3N2O2/c1-8(12-6-11(17)7-13(18)14(12)21)19-20-15(22)9-2-4-10(16)5-3-9/h2-7,21H,1H3,(H,20,22) |
| InChIKey | BPKJIXRJYCGNGG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|