C17H17ClN2O — CID 689927
4-chloro-N-[1-(2,5-dimethylphenyl)ethylideneamino]benzamide (PubChem CID 689927) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is 4-chloro-N-[1-(2,5-dimethylphenyl)ethylideneamino]benzamide.
| Compound Name | 4-chloro-N-[1-(2,5-dimethylphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 689927 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 4-chloro-N-[1-(2,5-dimethylphenyl)ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccc(Cl)cc1)c1cc(C)ccc1C |
| InChI | InChI=1S/C17H17ClN2O/c1-11-4-5-12(2)16(10-11)13(3)19-20-17(21)14-6-8-15(18)9-7-14/h4-10H,1-3H3,(H,20,21) |
| InChIKey | MAMCRSLHUDVQHJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|