C24H22Cl2N2O4 — CID 135842175
N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-4-[(4-ethoxyphenoxy)methyl]benzamide (PubChem CID 135842175) has the molecular formula C24H22Cl2N2O4 and a molecular weight of 473.36 g/mol. Its IUPAC name is N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-4-[(4-ethoxyphenoxy)methyl]benzamide.
| Compound Name | N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-4-[(4-ethoxyphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 135842175 |
| Molecular Formula | C24H22Cl2N2O4 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-4-[(4-ethoxyphenoxy)methyl]benzamide |
| SMILES | CCOc1ccc(OCc2ccc(C(=O)N/N=C(\C)c3cc(Cl)cc(Cl)c3O)cc2)cc1 |
| InChI | InChI=1S/C24H22Cl2N2O4/c1-3-31-19-8-10-20(11-9-19)32-14-16-4-6-17(7-5-16)24(30)28-27-15(2)21-12-18(25)13-22(26)23(21)29/h4-13,29H,3,14H2,1-2H3,(H,28,30)/b27-15+ |
| InChIKey | KTZPEVLFEZLZJT-JFLMPSFJSA-N |
| XLogP | 5.83 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|