C24H22Cl2N2O3 — CID 6027125
N-[(Z)-1-(2,4-dichlorophenyl)ethylideneamino]-4-[(4-ethoxyphenoxy)methyl]benzamide (PubChem CID 6027125) has the molecular formula C24H22Cl2N2O3 and a molecular weight of 457.36 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dichlorophenyl)ethylideneamino]-4-[(4-ethoxyphenoxy)methyl]benzamide.
| Compound Name | N-[(Z)-1-(2,4-dichlorophenyl)ethylideneamino]-4-[(4-ethoxyphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 6027125 |
| Molecular Formula | C24H22Cl2N2O3 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | N-[(Z)-1-(2,4-dichlorophenyl)ethylideneamino]-4-[(4-ethoxyphenoxy)methyl]benzamide |
| SMILES | CCOc1ccc(OCc2ccc(C(=O)N/N=C(/C)c3ccc(Cl)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C24H22Cl2N2O3/c1-3-30-20-9-11-21(12-10-20)31-15-17-4-6-18(7-5-17)24(29)28-27-16(2)22-13-8-19(25)14-23(22)26/h4-14H,3,15H2,1-2H3,(H,28,29)/b27-16- |
| InChIKey | ZWYIFLOOQBHYLJ-YUMHPJSZSA-N |
| XLogP | 6.13 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|