C25H26N2O5 — CID 135752121
4-[(4-ethoxyphenoxy)methyl]-N-[(E)-1-(2-hydroxy-4-methoxyphenyl)ethylideneamino]benzamide (PubChem CID 135752121) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is 4-[(4-ethoxyphenoxy)methyl]-N-[(E)-1-(2-hydroxy-4-methoxyphenyl)ethylideneamino]benzamide.
| Compound Name | 4-[(4-ethoxyphenoxy)methyl]-N-[(E)-1-(2-hydroxy-4-methoxyphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 135752121 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 4-[(4-ethoxyphenoxy)methyl]-N-[(E)-1-(2-hydroxy-4-methoxyphenyl)ethylideneamino]benzamide |
| SMILES | CCOc1ccc(OCc2ccc(C(=O)N/N=C(\C)c3ccc(OC)cc3O)cc2)cc1 |
| InChI | InChI=1S/C25H26N2O5/c1-4-31-20-9-11-21(12-10-20)32-16-18-5-7-19(8-6-18)25(29)27-26-17(2)23-14-13-22(30-3)15-24(23)28/h5-15,28H,4,16H2,1-3H3,(H,27,29)/b26-17+ |
| InChIKey | ISDREDBGCSBZTR-YZSQISJMSA-N |
| XLogP | 4.53 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|