C23H30N2O6 — CID 22830699
N-[(E)-1-(2,4-dimethoxyphenyl)ethylideneamino]-3,4,5-triethoxybenzamide (PubChem CID 22830699) has the molecular formula C23H30N2O6 and a molecular weight of 430.50 g/mol. Its IUPAC name is N-[(E)-1-(2,4-dimethoxyphenyl)ethylideneamino]-3,4,5-triethoxybenzamide.
| Compound Name | N-[(E)-1-(2,4-dimethoxyphenyl)ethylideneamino]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 22830699 |
| Molecular Formula | C23H30N2O6 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | N-[(E)-1-(2,4-dimethoxyphenyl)ethylideneamino]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)N/N=C(\C)c2ccc(OC)cc2OC)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H30N2O6/c1-7-29-20-12-16(13-21(30-8-2)22(20)31-9-3)23(26)25-24-15(4)18-11-10-17(27-5)14-19(18)28-6/h10-14H,7-9H2,1-6H3,(H,25,26)/b24-15+ |
| InChIKey | ZPYDPDPXQXFYSO-BUVRLJJBSA-N |
| XLogP | 4.05 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|