C22H28N2O6 — CID 3718576
3,4,5-triethoxy-N-[1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]benzamide (PubChem CID 3718576) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 3718576 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 3,4,5-triethoxy-N-[1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]benzamide |
| SMILES | CCOc1cc(C(=O)NN=C(C)c2ccc(O)c(OC)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H28N2O6/c1-6-28-19-12-16(13-20(29-7-2)21(19)30-8-3)22(26)24-23-14(4)15-9-10-17(25)18(11-15)27-5/h9-13,25H,6-8H2,1-5H3,(H,24,26) |
| InChIKey | RKUYPGZPDFLZPA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|