C20H25N3O4 — CID 6036284
3,4,5-triethoxy-N-[(Z)-1-pyridin-3-ylethylideneamino]benzamide (PubChem CID 6036284) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(Z)-1-pyridin-3-ylethylideneamino]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[(Z)-1-pyridin-3-ylethylideneamino]benzamide |
|---|---|
| PubChem CID | 6036284 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 3,4,5-triethoxy-N-[(Z)-1-pyridin-3-ylethylideneamino]benzamide |
| SMILES | CCOc1cc(C(=O)N/N=C(/C)c2cccnc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H25N3O4/c1-5-25-17-11-16(12-18(26-6-2)19(17)27-7-3)20(24)23-22-14(4)15-9-8-10-21-13-15/h8-13H,5-7H2,1-4H3,(H,23,24)/b22-14- |
| InChIKey | GHLJTDNJFDTASO-HMAPJEAMSA-N |
| XLogP | 3.43 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|