C26H29N3O5 — CID 108925490
N-[4-[[(3,4,5-triethoxybenzoyl)amino]methyl]phenyl]pyridine-3-carboxamide (PubChem CID 108925490) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is N-[4-[[(3,4,5-triethoxybenzoyl)amino]methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[4-[[(3,4,5-triethoxybenzoyl)amino]methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108925490 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-[4-[[(3,4,5-triethoxybenzoyl)amino]methyl]phenyl]pyridine-3-carboxamide |
| SMILES | CCOc1cc(C(=O)NCc2ccc(NC(=O)c3cccnc3)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C26H29N3O5/c1-4-32-22-14-20(15-23(33-5-2)24(22)34-6-3)25(30)28-16-18-9-11-21(12-10-18)29-26(31)19-8-7-13-27-17-19/h7-15,17H,4-6,16H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | UPMGXTBAZKNULS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |