C22H25F3N2O5 — CID 108933641
3,4,5-triethoxy-N-[4-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]benzamide (PubChem CID 108933641) has the molecular formula C22H25F3N2O5 and a molecular weight of 454.45 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[4-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[4-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 108933641 |
| Molecular Formula | C22H25F3N2O5 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 3,4,5-triethoxy-N-[4-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(CNC(=O)C(F)(F)F)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H25F3N2O5/c1-4-30-17-11-15(12-18(31-5-2)19(17)32-6-3)20(28)27-16-9-7-14(8-10-16)13-26-21(29)22(23,24)25/h7-12H,4-6,13H2,1-3H3,(H,26,29)(H,27,28) |
| InChIKey | KSKGUWAFPLVOCS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |