C24H26N2O6 — CID 1112721
N-[4-[(3,4,5-triethoxybenzoyl)amino]phenyl]furan-2-carboxamide (PubChem CID 1112721) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is N-[4-[(3,4,5-triethoxybenzoyl)amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(3,4,5-triethoxybenzoyl)amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1112721 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-[4-[(3,4,5-triethoxybenzoyl)amino]phenyl]furan-2-carboxamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(NC(=O)c3ccco3)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H26N2O6/c1-4-29-20-14-16(15-21(30-5-2)22(20)31-6-3)23(27)25-17-9-11-18(12-10-17)26-24(28)19-8-7-13-32-19/h7-15H,4-6H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | BXDPFYUUWAHNAS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |