C25H28N2O7 — CID 2913347
N-[2-methoxy-4-[(3,4,5-triethoxybenzoyl)amino]phenyl]furan-2-carboxamide (PubChem CID 2913347) has the molecular formula C25H28N2O7 and a molecular weight of 468.51 g/mol. Its IUPAC name is N-[2-methoxy-4-[(3,4,5-triethoxybenzoyl)amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-methoxy-4-[(3,4,5-triethoxybenzoyl)amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2913347 |
| Molecular Formula | C25H28N2O7 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | N-[2-methoxy-4-[(3,4,5-triethoxybenzoyl)amino]phenyl]furan-2-carboxamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(NC(=O)c3ccco3)c(OC)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H28N2O7/c1-5-31-21-13-16(14-22(32-6-2)23(21)33-7-3)24(28)26-17-10-11-18(20(15-17)30-4)27-25(29)19-9-8-12-34-19/h8-15H,5-7H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | GOEVXSAPAKZSDR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |