C26H22N2O5 — CID 5348268
N-[2-methoxy-4-[(3-phenylmethoxybenzoyl)amino]phenyl]furan-2-carboxamide (PubChem CID 5348268) has the molecular formula C26H22N2O5 and a molecular weight of 442.47 g/mol. Its IUPAC name is N-[2-methoxy-4-[(3-phenylmethoxybenzoyl)amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-methoxy-4-[(3-phenylmethoxybenzoyl)amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 5348268 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-[2-methoxy-4-[(3-phenylmethoxybenzoyl)amino]phenyl]furan-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2cccc(OCc3ccccc3)c2)ccc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C26H22N2O5/c1-31-24-16-20(12-13-22(24)28-26(30)23-11-6-14-32-23)27-25(29)19-9-5-10-21(15-19)33-17-18-7-3-2-4-8-18/h2-16H,17H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | CNIMKIUXUIRCFI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |