C21H19BrN2O5 — CID 1015959
N-[4-[(3-bromo-4-ethoxybenzoyl)amino]-2-methoxyphenyl]furan-2-carboxamide (PubChem CID 1015959) has the molecular formula C21H19BrN2O5 and a molecular weight of 459.30 g/mol. Its IUPAC name is N-[4-[(3-bromo-4-ethoxybenzoyl)amino]-2-methoxyphenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(3-bromo-4-ethoxybenzoyl)amino]-2-methoxyphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1015959 |
| Molecular Formula | C21H19BrN2O5 |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | N-[4-[(3-bromo-4-ethoxybenzoyl)amino]-2-methoxyphenyl]furan-2-carboxamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(NC(=O)c3ccco3)c(OC)c2)cc1Br |
| InChI | InChI=1S/C21H19BrN2O5/c1-3-28-17-9-6-13(11-15(17)22)20(25)23-14-7-8-16(19(12-14)27-2)24-21(26)18-5-4-10-29-18/h4-12H,3H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | OQKYOLSGZFKURJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |