C23H23N3O6 — CID 4788258
N-[5-[[(4-ethoxy-3-methoxybenzoyl)amino]carbamoyl]-2-methylphenyl]furan-2-carboxamide (PubChem CID 4788258) has the molecular formula C23H23N3O6 and a molecular weight of 437.45 g/mol. Its IUPAC name is N-[5-[[(4-ethoxy-3-methoxybenzoyl)amino]carbamoyl]-2-methylphenyl]furan-2-carboxamide.
| Compound Name | N-[5-[[(4-ethoxy-3-methoxybenzoyl)amino]carbamoyl]-2-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4788258 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-[5-[[(4-ethoxy-3-methoxybenzoyl)amino]carbamoyl]-2-methylphenyl]furan-2-carboxamide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2ccc(C)c(NC(=O)c3ccco3)c2)cc1OC |
| InChI | InChI=1S/C23H23N3O6/c1-4-31-18-10-9-16(13-20(18)30-3)22(28)26-25-21(27)15-8-7-14(2)17(12-15)24-23(29)19-6-5-11-32-19/h5-13H,4H2,1-3H3,(H,24,29)(H,25,27)(H,26,28) |
| InChIKey | YSBUZVSVSSVQHF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|