C18H22N2O4 — CID 17475602
N-[5-(3-ethoxypropylcarbamoyl)-2-methylphenyl]furan-2-carboxamide (PubChem CID 17475602) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is N-[5-(3-ethoxypropylcarbamoyl)-2-methylphenyl]furan-2-carboxamide.
| Compound Name | N-[5-(3-ethoxypropylcarbamoyl)-2-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17475602 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-[5-(3-ethoxypropylcarbamoyl)-2-methylphenyl]furan-2-carboxamide |
| SMILES | CCOCCCNC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C18H22N2O4/c1-3-23-10-5-9-19-17(21)14-8-7-13(2)15(12-14)20-18(22)16-6-4-11-24-16/h4,6-8,11-12H,3,5,9-10H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | VLVBFNSQRYMFIQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|