C22H30N2O3 — CID 55555001
N-[2-methyl-5-(nonylcarbamoyl)phenyl]furan-2-carboxamide (PubChem CID 55555001) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is N-[2-methyl-5-(nonylcarbamoyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[2-methyl-5-(nonylcarbamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55555001 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | N-[2-methyl-5-(nonylcarbamoyl)phenyl]furan-2-carboxamide |
| SMILES | CCCCCCCCCNC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C22H30N2O3/c1-3-4-5-6-7-8-9-14-23-21(25)18-13-12-17(2)19(16-18)24-22(26)20-11-10-15-27-20/h10-13,15-16H,3-9,14H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | BRZOQZUBCASWFE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|