C21H20N2O5S — CID 55613641
N-[5-[(2-ethylsulfonylphenyl)carbamoyl]-2-methylphenyl]furan-2-carboxamide (PubChem CID 55613641) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is N-[5-[(2-ethylsulfonylphenyl)carbamoyl]-2-methylphenyl]furan-2-carboxamide.
| Compound Name | N-[5-[(2-ethylsulfonylphenyl)carbamoyl]-2-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55613641 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[5-[(2-ethylsulfonylphenyl)carbamoyl]-2-methylphenyl]furan-2-carboxamide |
| SMILES | CCS(=O)(=O)c1ccccc1NC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C21H20N2O5S/c1-3-29(26,27)19-9-5-4-7-16(19)22-20(24)15-11-10-14(2)17(13-15)23-21(25)18-8-6-12-28-18/h4-13H,3H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | XRIQZHFCNRGWSM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |